C16H34N4O6 — CID 59610079
5-(diaminomethylideneamino)-2-[[3-[2-(1-ethoxypropan-2-yloxy)ethoxy]-2-hydroxypropyl]amino]pentanoic acid (PubChem CID 59610079) has the molecular formula C16H34N4O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[3-[2-(1-ethoxypropan-2-yloxy)ethoxy]-2-hydroxypropyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[[3-[2-(1-ethoxypropan-2-yloxy)ethoxy]-2-hydroxypropyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 59610079 |
| Molecular Formula | C16H34N4O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[3-[2-(1-ethoxypropan-2-yloxy)ethoxy]-2-hydroxypropyl]amino]pentanoic acid |
| SMILES | CCOCC(C)OCCOCC(O)CNC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C16H34N4O6/c1-3-24-10-12(2)26-8-7-25-11-13(21)9-20-14(15(22)23)5-4-6-19-16(17)18/h12-14,20-21H,3-11H2,1-2H3,(H,22,23)(H4,17,18,19) |
| InChIKey | DMAPNQMDNQCDSC-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 161.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|