C12H24N4O4 — CID 87456042
(2S)-5-(diaminomethylideneamino)-2-[(2-hydroxy-3-prop-2-enoxypropyl)amino]pentanoic acid (PubChem CID 87456042) has the molecular formula C12H24N4O4 and a molecular weight of 288.35 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[(2-hydroxy-3-prop-2-enoxypropyl)amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[(2-hydroxy-3-prop-2-enoxypropyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 87456042 |
| Molecular Formula | C12H24N4O4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[(2-hydroxy-3-prop-2-enoxypropyl)amino]pentanoic acid |
| SMILES | C=CCOCC(O)CN[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C12H24N4O4/c1-2-6-20-8-9(17)7-16-10(11(18)19)4-3-5-15-12(13)14/h2,9-10,16-17H,1,3-8H2,(H,18,19)(H4,13,14,15)/t9?,10-/m0/s1 |
| InChIKey | ZCSJHMRKQNNOCT-AXDSSHIGSA-N |
| XLogP | -1.35 |
| TPSA | 143.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|