C9H18N4O2S — CID 22853938
(2S)-6-(diaminomethylideneamino)-2-(2-sulfanylideneethylamino)hexanoic acid (PubChem CID 22853938) has the molecular formula C9H18N4O2S and a molecular weight of 246.34 g/mol. Its IUPAC name is (2S)-6-(diaminomethylideneamino)-2-(2-sulfanylideneethylamino)hexanoic acid.
| Compound Name | (2S)-6-(diaminomethylideneamino)-2-(2-sulfanylideneethylamino)hexanoic acid |
|---|---|
| PubChem CID | 22853938 |
| Molecular Formula | C9H18N4O2S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | (2S)-6-(diaminomethylideneamino)-2-(2-sulfanylideneethylamino)hexanoic acid |
| SMILES | NC(N)=NCCCC[C@H](NCC=S)C(=O)O |
| InChI | InChI=1S/C9H18N4O2S/c10-9(11)13-4-2-1-3-7(8(14)15)12-5-6-16/h6-7,12H,1-5H2,(H,14,15)(H4,10,11,13)/t7-/m0/s1 |
| InChIKey | UWHIDNNCKHGECG-ZETCQYMHSA-N |
| XLogP | -0.53 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|