C10H21N5O3S — CID 175735007
(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-6-(diaminomethylideneamino)hexanoic acid (PubChem CID 175735007) has the molecular formula C10H21N5O3S and a molecular weight of 291.38 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-6-(diaminomethylideneamino)hexanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-6-(diaminomethylideneamino)hexanoic acid |
|---|---|
| PubChem CID | 175735007 |
| Molecular Formula | C10H21N5O3S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-6-(diaminomethylideneamino)hexanoic acid |
| SMILES | NC(N)=NCCCC[C@H](NC(=O)[C@@H](N)CS)C(=O)O |
| InChI | InChI=1S/C10H21N5O3S/c11-6(5-19)8(16)15-7(9(17)18)3-1-2-4-14-10(12)13/h6-7,19H,1-5,11H2,(H,15,16)(H,17,18)(H4,12,13,14)/t6-,7-/m0/s1 |
| InChIKey | BBUYMLDFBLDRPB-BQBZGAKWSA-N |
| XLogP | -1.74 |
| TPSA | 156.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|