C17H26N8O4S — CID 10526992
(2R)-5-(diaminomethylideneamino)-2-[5-(6-sulfanylidene-3H-purin-9-yl)pentoxycarbonylamino]pentanoic acid (PubChem CID 10526992) has the molecular formula C17H26N8O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[5-(6-sulfanylidene-3H-purin-9-yl)pentoxycarbonylamino]pentanoic acid.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[5-(6-sulfanylidene-3H-purin-9-yl)pentoxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 10526992 |
| Molecular Formula | C17H26N8O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[5-(6-sulfanylidene-3H-purin-9-yl)pentoxycarbonylamino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@@H](NC(=O)OCCCCCn1cnc2c(=S)nc[nH]c21)C(=O)O |
| InChI | InChI=1S/C17H26N8O4S/c18-16(19)20-6-4-5-11(15(26)27)24-17(28)29-8-3-1-2-7-25-10-23-12-13(25)21-9-22-14(12)30/h9-11H,1-8H2,(H,24,28)(H,26,27)(H4,18,19,20)(H,21,22,30)/t11-/m1/s1 |
| InChIKey | OILGALUUGYJGNR-LLVKDONJSA-N |
| XLogP | 0.89 |
| TPSA | 186.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|