C19H30BrN9O4 — CID 54147771
2-[5-[8-bromo-6-(dimethylamino)purin-9-yl]pentoxycarbonylamino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 54147771) has the molecular formula C19H30BrN9O4 and a molecular weight of 528.41 g/mol. Its IUPAC name is 2-[5-[8-bromo-6-(dimethylamino)purin-9-yl]pentoxycarbonylamino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[5-[8-bromo-6-(dimethylamino)purin-9-yl]pentoxycarbonylamino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 54147771 |
| Molecular Formula | C19H30BrN9O4 |
| Molecular Weight | 528.41 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 2-[5-[8-bromo-6-(dimethylamino)purin-9-yl]pentoxycarbonylamino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CN(C)c1ncnc2c1nc(Br)n2CCCCCOC(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C19H30BrN9O4/c1-28(2)14-13-15(25-11-24-14)29(17(20)27-13)9-4-3-5-10-33-19(32)26-12(16(30)31)7-6-8-23-18(21)22/h11-12H,3-10H2,1-2H3,(H,26,32)(H,30,31)(H4,21,22,23) |
| InChIKey | OFPAWZNJPAZZEB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 186.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|