C18H30N10O4 — CID 10742187
(2R)-5-(diaminomethylideneamino)-2-[2-[2-[6-(dimethylamino)purin-9-yl]ethylamino]ethoxycarbonylamino]pentanoic acid (PubChem CID 10742187) has the molecular formula C18H30N10O4 and a molecular weight of 450.50 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[2-[2-[6-(dimethylamino)purin-9-yl]ethylamino]ethoxycarbonylamino]pentanoic acid.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[2-[2-[6-(dimethylamino)purin-9-yl]ethylamino]ethoxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 10742187 |
| Molecular Formula | C18H30N10O4 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[2-[2-[6-(dimethylamino)purin-9-yl]ethylamino]ethoxycarbonylamino]pentanoic acid |
| SMILES | CN(C)c1ncnc2c1ncn2CCNCCOC(=O)N[C@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C18H30N10O4/c1-27(2)14-13-15(24-10-23-14)28(11-25-13)8-6-21-7-9-32-18(31)26-12(16(29)30)4-3-5-22-17(19)20/h10-12,21H,3-9H2,1-2H3,(H,26,31)(H,29,30)(H4,19,20,22)/t12-/m1/s1 |
| InChIKey | UFQRDQRNYPCSNF-GFCCVEGCSA-N |
| XLogP | -1.29 |
| TPSA | 198.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|