C10H13N5O3 — CID 11230471
3-[6-(dimethylamino)purin-9-yl]-2-hydroxypropanoic acid (PubChem CID 11230471) has the molecular formula C10H13N5O3 and a molecular weight of 251.25 g/mol. Its IUPAC name is 3-[6-(dimethylamino)purin-9-yl]-2-hydroxypropanoic acid.
| Compound Name | 3-[6-(dimethylamino)purin-9-yl]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 11230471 |
| Molecular Formula | C10H13N5O3 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 3-[6-(dimethylamino)purin-9-yl]-2-hydroxypropanoic acid |
| SMILES | CN(C)c1ncnc2c1ncn2CC(O)C(=O)O |
| InChI | InChI=1S/C10H13N5O3/c1-14(2)8-7-9(12-4-11-8)15(5-13-7)3-6(16)10(17)18/h4-6,16H,3H2,1-2H3,(H,17,18) |
| InChIKey | YPBXKOOYLVIYDM-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |