C14H22N6O — CID 146108059
2-[6-(dimethylamino)purin-9-yl]-N-(2,2-dimethylpropyl)acetamide (PubChem CID 146108059) has the molecular formula C14H22N6O and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-[6-(dimethylamino)purin-9-yl]-N-(2,2-dimethylpropyl)acetamide.
| Compound Name | 2-[6-(dimethylamino)purin-9-yl]-N-(2,2-dimethylpropyl)acetamide |
|---|---|
| PubChem CID | 146108059 |
| Molecular Formula | C14H22N6O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 2-[6-(dimethylamino)purin-9-yl]-N-(2,2-dimethylpropyl)acetamide |
| SMILES | CN(C)c1ncnc2c1ncn2CC(=O)NCC(C)(C)C |
| InChI | InChI=1S/C14H22N6O/c1-14(2,3)7-15-10(21)6-20-9-18-11-12(19(4)5)16-8-17-13(11)20/h8-9H,6-7H2,1-5H3,(H,15,21) |
| InChIKey | VYCDSGFJWRGIFH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |