C15H17N5 — CID 14022452
N,N-dimethyl-9-[(2-methylphenyl)methyl]purin-6-amine (PubChem CID 14022452) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is N,N-dimethyl-9-[(2-methylphenyl)methyl]purin-6-amine.
| Compound Name | N,N-dimethyl-9-[(2-methylphenyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 14022452 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N,N-dimethyl-9-[(2-methylphenyl)methyl]purin-6-amine |
| SMILES | Cc1ccccc1Cn1cnc2c(N(C)C)ncnc21 |
| InChI | InChI=1S/C15H17N5/c1-11-6-4-5-7-12(11)8-20-10-18-13-14(19(2)3)16-9-17-15(13)20/h4-7,9-10H,8H2,1-3H3 |
| InChIKey | LBLPEELLSUNQSY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |