C16H27N7 — CID 155552908
9-[3-(4-ethylpiperazin-1-yl)propyl]-N,N-dimethylpurin-6-amine (PubChem CID 155552908) has the molecular formula C16H27N7 and a molecular weight of 317.44 g/mol. Its IUPAC name is 9-[3-(4-ethylpiperazin-1-yl)propyl]-N,N-dimethylpurin-6-amine.
| Compound Name | 9-[3-(4-ethylpiperazin-1-yl)propyl]-N,N-dimethylpurin-6-amine |
|---|---|
| PubChem CID | 155552908 |
| Molecular Formula | C16H27N7 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.23 |
| IUPAC Name | 9-[3-(4-ethylpiperazin-1-yl)propyl]-N,N-dimethylpurin-6-amine |
| SMILES | CCN1CCN(CCCn2cnc3c(N(C)C)ncnc32)CC1 |
| InChI | InChI=1S/C16H27N7/c1-4-21-8-10-22(11-9-21)6-5-7-23-13-19-14-15(20(2)3)17-12-18-16(14)23/h12-13H,4-11H2,1-3H3 |
| InChIKey | JGNOQUNBIQJUEU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 53.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |