C13H19N5O4 — CID 154099172
(2R,3R)-4-[6-(diethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid (PubChem CID 154099172) has the molecular formula C13H19N5O4 and a molecular weight of 309.33 g/mol. Its IUPAC name is (2R,3R)-4-[6-(diethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid.
| Compound Name | (2R,3R)-4-[6-(diethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 154099172 |
| Molecular Formula | C13H19N5O4 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (2R,3R)-4-[6-(diethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid |
| SMILES | CCN(CC)c1ncnc2c1ncn2C[C@@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C13H19N5O4/c1-3-17(4-2)11-9-12(15-6-14-11)18(7-16-9)5-8(19)10(20)13(21)22/h6-8,10,19-20H,3-5H2,1-2H3,(H,21,22)/t8-,10-/m1/s1 |
| InChIKey | KMEDBJNRJKROEO-PSASIEDQSA-N |
| XLogP | -0.52 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |