C10H13N5O4S — CID 160816637
(2R,3R)-4-(6-amino-2-methylsulfanylpurin-9-yl)-2,3-dihydroxybutanoic acid (PubChem CID 160816637) has the molecular formula C10H13N5O4S and a molecular weight of 299.31 g/mol. Its IUPAC name is (2R,3R)-4-(6-amino-2-methylsulfanylpurin-9-yl)-2,3-dihydroxybutanoic acid.
| Compound Name | (2R,3R)-4-(6-amino-2-methylsulfanylpurin-9-yl)-2,3-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 160816637 |
| Molecular Formula | C10H13N5O4S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | (2R,3R)-4-(6-amino-2-methylsulfanylpurin-9-yl)-2,3-dihydroxybutanoic acid |
| SMILES | CSc1nc(N)c2ncn(C[C@@H](O)[C@@H](O)C(=O)O)c2n1 |
| InChI | InChI=1S/C10H13N5O4S/c1-20-10-13-7(11)5-8(14-10)15(3-12-5)2-4(16)6(17)9(18)19/h3-4,6,16-17H,2H2,1H3,(H,18,19)(H2,11,13,14)/t4-,6-/m1/s1 |
| InChIKey | SEZIUTHZDBJOBF-INEUFUBQSA-N |
| XLogP | -1.06 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |