C8H12N6O — CID 70039769
(2R)-1-(2,6-diaminopurin-9-yl)propan-2-ol (PubChem CID 70039769) has the molecular formula C8H12N6O and a molecular weight of 208.23 g/mol. Its IUPAC name is (2R)-1-(2,6-diaminopurin-9-yl)propan-2-ol.
| Compound Name | (2R)-1-(2,6-diaminopurin-9-yl)propan-2-ol |
|---|---|
| PubChem CID | 70039769 |
| Molecular Formula | C8H12N6O |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (2R)-1-(2,6-diaminopurin-9-yl)propan-2-ol |
| SMILES | C[C@@H](O)Cn1cnc2c(N)nc(N)nc21 |
| InChI | InChI=1S/C8H12N6O/c1-4(15)2-14-3-11-5-6(9)12-8(10)13-7(5)14/h3-4,15H,2H2,1H3,(H4,9,10,12,13)/t4-/m1/s1 |
| InChIKey | PGYYDIUNULKKOD-SCSAIBSYSA-N |
| XLogP | -0.63 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |