C15H18N6 — CID 154781600
9-[(3-propan-2-ylphenyl)methyl]purine-2,6-diamine (PubChem CID 154781600) has the molecular formula C15H18N6 and a molecular weight of 282.35 g/mol. Its IUPAC name is 9-[(3-propan-2-ylphenyl)methyl]purine-2,6-diamine.
| Compound Name | 9-[(3-propan-2-ylphenyl)methyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 154781600 |
| Molecular Formula | C15H18N6 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 9-[(3-propan-2-ylphenyl)methyl]purine-2,6-diamine |
| SMILES | CC(C)c1cccc(Cn2cnc3c(N)nc(N)nc32)c1 |
| InChI | InChI=1S/C15H18N6/c1-9(2)11-5-3-4-10(6-11)7-21-8-18-12-13(16)19-15(17)20-14(12)21/h3-6,8-9H,7H2,1-2H3,(H4,16,17,19,20) |
| InChIKey | LOQIKGKORGWAJM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |