C18H24N5O3P — CID 68840552
[3-[(6-amino-2-butoxypurin-9-yl)methyl]phenyl]methyl-methylphosphinic acid (PubChem CID 68840552) has the molecular formula C18H24N5O3P and a molecular weight of 389.40 g/mol. Its IUPAC name is [3-[(6-amino-2-butoxypurin-9-yl)methyl]phenyl]methyl-methylphosphinic acid.
| Compound Name | [3-[(6-amino-2-butoxypurin-9-yl)methyl]phenyl]methyl-methylphosphinic acid |
|---|---|
| PubChem CID | 68840552 |
| Molecular Formula | C18H24N5O3P |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | [3-[(6-amino-2-butoxypurin-9-yl)methyl]phenyl]methyl-methylphosphinic acid |
| SMILES | CCCCOc1nc(N)c2ncn(Cc3cccc(CP(C)(=O)O)c3)c2n1 |
| InChI | InChI=1S/C18H24N5O3P/c1-3-4-8-26-18-21-16(19)15-17(22-18)23(12-20-15)10-13-6-5-7-14(9-13)11-27(2,24)25/h5-7,9,12H,3-4,8,10-11H2,1-2H3,(H,24,25)(H2,19,21,22) |
| InChIKey | CIDLIEXRXHEOPX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|