C19H20F3N5O3 — CID 23158739
methyl 2-[3-[[6-amino-2-(4,4,4-trifluorobutoxy)purin-9-yl]methyl]phenyl]acetate (PubChem CID 23158739) has the molecular formula C19H20F3N5O3 and a molecular weight of 423.40 g/mol. Its IUPAC name is methyl 2-[3-[[6-amino-2-(4,4,4-trifluorobutoxy)purin-9-yl]methyl]phenyl]acetate.
| Compound Name | methyl 2-[3-[[6-amino-2-(4,4,4-trifluorobutoxy)purin-9-yl]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 23158739 |
| Molecular Formula | C19H20F3N5O3 |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | methyl 2-[3-[[6-amino-2-(4,4,4-trifluorobutoxy)purin-9-yl]methyl]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(Cn2cnc3c(N)nc(OCCCC(F)(F)F)nc32)c1 |
| InChI | InChI=1S/C19H20F3N5O3/c1-29-14(28)9-12-4-2-5-13(8-12)10-27-11-24-15-16(23)25-18(26-17(15)27)30-7-3-6-19(20,21)22/h2,4-5,8,11H,3,6-7,9-10H2,1H3,(H2,23,25,26) |
| InChIKey | IDODLTIKJUVJLT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|