C42H54N10O10 — CID 159745732
methyl 2-[3-[(6-amino-2-butoxypurin-9-yl)methyl]phenyl]-2,2-dimethoxyacetate (PubChem CID 159745732) has the molecular formula C42H54N10O10 and a molecular weight of 858.95 g/mol. Its IUPAC name is methyl 2-[3-[(6-amino-2-butoxypurin-9-yl)methyl]phenyl]-2,2-dimethoxyacetate.
| Compound Name | methyl 2-[3-[(6-amino-2-butoxypurin-9-yl)methyl]phenyl]-2,2-dimethoxyacetate |
|---|---|
| PubChem CID | 159745732 |
| Molecular Formula | C42H54N10O10 |
| Molecular Weight | 858.95 g/mol |
| Exact Mass | 858.40 |
| IUPAC Name | methyl 2-[3-[(6-amino-2-butoxypurin-9-yl)methyl]phenyl]-2,2-dimethoxyacetate |
| SMILES | CCCCOc1nc(N)c2ncn(Cc3cccc(C(OC)(OC)C(=O)OC)c3)c2n1.CCCCOc1nc(N)c2ncn(Cc3cccc(C(OC)(OC)C(=O)OC)c3)c2n1 |
| InChI | InChI=1S/2C21H27N5O5/c2*1-5-6-10-31-20-24-17(22)16-18(25-20)26(13-23-16)12-14-8-7-9-15(11-14)21(29-3,30-4)19(27)28-2/h2*7-9,11,13H,5-6,10,12H2,1-4H3,(H2,22,24,25) |
| InChIKey | NDADHXHVQSTFFC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 247.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.95 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|