C34H39IN10O8 — CID 162189077
3-[[6-amino-2-(2-methoxyethoxy)purin-9-yl]methyl]benzoic acid;iodomethane;methyl 3-[[6-amino-2-(2-methoxyethoxy)purin-9-yl]methyl]benzoate (PubChem CID 162189077) has the molecular formula C34H39IN10O8 and a molecular weight of 842.65 g/mol. Its IUPAC name is 3-[[6-amino-2-(2-methoxyethoxy)purin-9-yl]methyl]benzoic acid;iodomethane;methyl 3-[[6-amino-2-(2-methoxyethoxy)purin-9-yl]methyl]benzoate.
| Compound Name | 3-[[6-amino-2-(2-methoxyethoxy)purin-9-yl]methyl]benzoic acid;iodomethane;methyl 3-[[6-amino-2-(2-methoxyethoxy)purin-9-yl]methyl]benzoate |
|---|---|
| PubChem CID | 162189077 |
| Molecular Formula | C34H39IN10O8 |
| Molecular Weight | 842.65 g/mol |
| Exact Mass | 842.20 |
| IUPAC Name | 3-[[6-amino-2-(2-methoxyethoxy)purin-9-yl]methyl]benzoic acid;iodomethane;methyl 3-[[6-amino-2-(2-methoxyethoxy)purin-9-yl]methyl]benzoate |
| SMILES | CI.COCCOc1nc(N)c2ncn(Cc3cccc(C(=O)O)c3)c2n1.COCCOc1nc(N)c2ncn(Cc3cccc(C(=O)OC)c3)c2n1 |
| InChI | InChI=1S/C17H19N5O4.C16H17N5O4.CH3I/c1-24-6-7-26-17-20-14(18)13-15(21-17)22(10-19-13)9-11-4-3-5-12(8-11)16(23)25-2;1-24-5-6-25-16-19-13(17)12-14(20-16)21(9-18-12)8-10-3-2-4-11(7-10)15(22)23;1-2/h3-5,8,10H,6-7,9H2,1-2H3,(H2,18,20,21);2-4,7,9H,5-6,8H2,1H3,(H,22,23)(H2,17,19,20);1H3 |
| InChIKey | ZQBBRLWJZCSBHS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 239.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.65 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|