C14H14N6O2 — CID 86187446
methyl 4-[(2,6-diaminopurin-9-yl)methyl]benzoate (PubChem CID 86187446) has the molecular formula C14H14N6O2 and a molecular weight of 298.31 g/mol. Its IUPAC name is methyl 4-[(2,6-diaminopurin-9-yl)methyl]benzoate.
| Compound Name | methyl 4-[(2,6-diaminopurin-9-yl)methyl]benzoate |
|---|---|
| PubChem CID | 86187446 |
| Molecular Formula | C14H14N6O2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | methyl 4-[(2,6-diaminopurin-9-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cn2cnc3c(N)nc(N)nc32)cc1 |
| InChI | InChI=1S/C14H14N6O2/c1-22-13(21)9-4-2-8(3-5-9)6-20-7-17-10-11(15)18-14(16)19-12(10)20/h2-5,7H,6H2,1H3,(H4,15,16,18,19) |
| InChIKey | PPWDWTVZAZWVGN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 121.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |