C26H30IN7O2 — CID 91038675
4-[[2-amino-6-[(4-iodophenyl)methoxy]purin-9-yl]methyl]-N,N',N'-triethylbenzohydrazide (PubChem CID 91038675) has the molecular formula C26H30IN7O2 and a molecular weight of 599.48 g/mol. Its IUPAC name is 4-[[2-amino-6-[(4-iodophenyl)methoxy]purin-9-yl]methyl]-N,N',N'-triethylbenzohydrazide.
| Compound Name | 4-[[2-amino-6-[(4-iodophenyl)methoxy]purin-9-yl]methyl]-N,N',N'-triethylbenzohydrazide |
|---|---|
| PubChem CID | 91038675 |
| Molecular Formula | C26H30IN7O2 |
| Molecular Weight | 599.48 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | 4-[[2-amino-6-[(4-iodophenyl)methoxy]purin-9-yl]methyl]-N,N',N'-triethylbenzohydrazide |
| SMILES | CCN(CC)N(CC)C(=O)c1ccc(Cn2cnc3c(OCc4ccc(I)cc4)nc(N)nc32)cc1 |
| InChI | InChI=1S/C26H30IN7O2/c1-4-33(5-2)34(6-3)25(35)20-11-7-18(8-12-20)15-32-17-29-22-23(32)30-26(28)31-24(22)36-16-19-9-13-21(27)14-10-19/h7-14,17H,4-6,15-16H2,1-3H3,(H2,28,30,31) |
| InChIKey | KJTMPUDXEHZDBZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|