C21H30N5O5P — CID 15667236
9-[2-(2-diethoxyphosphorylpropan-2-yloxy)ethyl]-6-phenylmethoxypurin-2-amine (PubChem CID 15667236) has the molecular formula C21H30N5O5P and a molecular weight of 463.48 g/mol. Its IUPAC name is 9-[2-(2-diethoxyphosphorylpropan-2-yloxy)ethyl]-6-phenylmethoxypurin-2-amine.
| Compound Name | 9-[2-(2-diethoxyphosphorylpropan-2-yloxy)ethyl]-6-phenylmethoxypurin-2-amine |
|---|---|
| PubChem CID | 15667236 |
| Molecular Formula | C21H30N5O5P |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 9-[2-(2-diethoxyphosphorylpropan-2-yloxy)ethyl]-6-phenylmethoxypurin-2-amine |
| SMILES | CCOP(=O)(OCC)C(C)(C)OCCn1cnc2c(OCc3ccccc3)nc(N)nc21 |
| InChI | InChI=1S/C21H30N5O5P/c1-5-30-32(27,31-6-2)21(3,4)29-13-12-26-15-23-17-18(26)24-20(22)25-19(17)28-14-16-10-8-7-9-11-16/h7-11,15H,5-6,12-14H2,1-4H3,(H2,22,24,25) |
| InChIKey | HTFPJRVZTFWZTI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|