C30H49N5O3Si2 — CID 11801419
9-[[(2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]methyl]-6-phenylmethoxypurin-2-amine (PubChem CID 11801419) has the molecular formula C30H49N5O3Si2 and a molecular weight of 583.93 g/mol. Its IUPAC name is 9-[[(2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]methyl]-6-phenylmethoxypurin-2-amine.
| Compound Name | 9-[[(2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]methyl]-6-phenylmethoxypurin-2-amine |
|---|---|
| PubChem CID | 11801419 |
| Molecular Formula | C30H49N5O3Si2 |
| Molecular Weight | 583.93 g/mol |
| Exact Mass | 583.34 |
| IUPAC Name | 9-[[(2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]methyl]-6-phenylmethoxypurin-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1C(Cn2cnc3c(OCc4ccccc4)nc(N)nc32)[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H49N5O3Si2/c1-29(2,3)39(7,8)37-18-23-22(24(23)19-38-40(9,10)30(4,5)6)16-35-20-32-25-26(35)33-28(31)34-27(25)36-17-21-14-12-11-13-15-21/h11-15,20,22-24H,16-19H2,1-10H3,(H2,31,33,34)/t23-,24-/m0/s1 |
| InChIKey | FUPJRRWTXRMBIL-ZEQRLZLVSA-N |
| XLogP | 6.89 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.93 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|