C21H30N6O5Si — CID 164884977
9-[2-[tert-butyl(dimethyl)silyl]oxyethoxymethyl]-6-[(2-nitrophenyl)methoxy]purin-2-amine (PubChem CID 164884977) has the molecular formula C21H30N6O5Si and a molecular weight of 474.59 g/mol. Its IUPAC name is 9-[2-[tert-butyl(dimethyl)silyl]oxyethoxymethyl]-6-[(2-nitrophenyl)methoxy]purin-2-amine.
| Compound Name | 9-[2-[tert-butyl(dimethyl)silyl]oxyethoxymethyl]-6-[(2-nitrophenyl)methoxy]purin-2-amine |
|---|---|
| PubChem CID | 164884977 |
| Molecular Formula | C21H30N6O5Si |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 9-[2-[tert-butyl(dimethyl)silyl]oxyethoxymethyl]-6-[(2-nitrophenyl)methoxy]purin-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCCOCn1cnc2c(OCc3ccccc3[N+](=O)[O-])nc(N)nc21 |
| InChI | InChI=1S/C21H30N6O5Si/c1-21(2,3)33(4,5)32-11-10-30-14-26-13-23-17-18(26)24-20(22)25-19(17)31-12-15-8-6-7-9-16(15)27(28)29/h6-9,13H,10-12,14H2,1-5H3,(H2,22,24,25) |
| InChIKey | SSMORCLZAQKDPP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|