C16H26FNO5Si — CID 178155414
tert-butyl-[2-[2-(4-fluoro-3-nitrophenoxy)ethoxy]ethoxy]-dimethylsilane (PubChem CID 178155414) has the molecular formula C16H26FNO5Si and a molecular weight of 359.47 g/mol. Its IUPAC name is tert-butyl-[2-[2-(4-fluoro-3-nitrophenoxy)ethoxy]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[2-(4-fluoro-3-nitrophenoxy)ethoxy]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 178155414 |
| Molecular Formula | C16H26FNO5Si |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | tert-butyl-[2-[2-(4-fluoro-3-nitrophenoxy)ethoxy]ethoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCOCCOc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H26FNO5Si/c1-16(2,3)24(4,5)23-11-9-21-8-10-22-13-6-7-14(17)15(12-13)18(19)20/h6-7,12H,8-11H2,1-5H3 |
| InChIKey | IPSRVBSHDXCIRF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|