C19H29NO6Si — CID 54251521
1-[5-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]-2-nitrophenyl]prop-2-en-1-one (PubChem CID 54251521) has the molecular formula C19H29NO6Si and a molecular weight of 395.53 g/mol. Its IUPAC name is 1-[5-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]-2-nitrophenyl]prop-2-en-1-one.
| Compound Name | 1-[5-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]-2-nitrophenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 54251521 |
| Molecular Formula | C19H29NO6Si |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 1-[5-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]-2-nitrophenyl]prop-2-en-1-one |
| SMILES | C=CC(=O)c1cc(OCCOCCO[Si](C)(C)C(C)(C)C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H29NO6Si/c1-7-18(21)16-14-15(8-9-17(16)20(22)23)25-12-10-24-11-13-26-27(5,6)19(2,3)4/h7-9,14H,1,10-13H2,2-6H3 |
| InChIKey | QXBPPJFKRQKLLM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|