C16H26O5Si — CID 162506085
4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-methoxybenzoic acid (PubChem CID 162506085) has the molecular formula C16H26O5Si and a molecular weight of 326.47 g/mol. Its IUPAC name is 4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-methoxybenzoic acid.
| Compound Name | 4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 162506085 |
| Molecular Formula | C16H26O5Si |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-methoxybenzoic acid |
| SMILES | COc1cc(OCCO[Si](C)(C)C(C)(C)C)ccc1C(=O)O |
| InChI | InChI=1S/C16H26O5Si/c1-16(2,3)22(5,6)21-10-9-20-12-7-8-13(15(17)18)14(11-12)19-4/h7-8,11H,9-10H2,1-6H3,(H,17,18) |
| InChIKey | JGBQCBJUOFGAMX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|