C29H30O12 — CID 86193789
2,4-bis[2-[2-(4-carboxyphenoxy)ethoxy]ethoxy]benzoic acid (PubChem CID 86193789) has the molecular formula C29H30O12 and a molecular weight of 570.55 g/mol. Its IUPAC name is 2,4-bis[2-[2-(4-carboxyphenoxy)ethoxy]ethoxy]benzoic acid.
| Compound Name | 2,4-bis[2-[2-(4-carboxyphenoxy)ethoxy]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 86193789 |
| Molecular Formula | C29H30O12 |
| Molecular Weight | 570.55 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | 2,4-bis[2-[2-(4-carboxyphenoxy)ethoxy]ethoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCOCCOc2ccc(C(=O)O)c(OCCOCCOc3ccc(C(=O)O)cc3)c2)cc1 |
| InChI | InChI=1S/C29H30O12/c30-27(31)20-1-5-22(6-2-20)38-15-11-36-13-17-40-24-9-10-25(29(34)35)26(19-24)41-18-14-37-12-16-39-23-7-3-21(4-8-23)28(32)33/h1-10,19H,11-18H2,(H,30,31)(H,32,33)(H,34,35) |
| InChIKey | HFEBHJHSASKRGD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 167.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|