C30H34O7 — CID 100915852
2-[10-[4-(4-hydroxyphenyl)phenoxy]decoxy]terephthalic acid (PubChem CID 100915852) has the molecular formula C30H34O7 and a molecular weight of 506.60 g/mol. Its IUPAC name is 2-[10-[4-(4-hydroxyphenyl)phenoxy]decoxy]terephthalic acid.
| Compound Name | 2-[10-[4-(4-hydroxyphenyl)phenoxy]decoxy]terephthalic acid |
|---|---|
| PubChem CID | 100915852 |
| Molecular Formula | C30H34O7 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 2-[10-[4-(4-hydroxyphenyl)phenoxy]decoxy]terephthalic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)c(OCCCCCCCCCCOc2ccc(-c3ccc(O)cc3)cc2)c1 |
| InChI | InChI=1S/C30H34O7/c31-25-14-9-22(10-15-25)23-11-16-26(17-12-23)36-19-7-5-3-1-2-4-6-8-20-37-28-21-24(29(32)33)13-18-27(28)30(34)35/h9-18,21,31H,1-8,19-20H2,(H,32,33)(H,34,35) |
| InChIKey | IALPWLAXTYNZAU-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|