C84H96N2O8 — CID 129047046
2,5-bis[6-[4-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]phenoxy]hexoxy]terephthalic acid (PubChem CID 129047046) has the molecular formula C84H96N2O8 and a molecular weight of 1261.70 g/mol. Its IUPAC name is 2,5-bis[6-[4-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]phenoxy]hexoxy]terephthalic acid.
| Compound Name | 2,5-bis[6-[4-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]phenoxy]hexoxy]terephthalic acid |
|---|---|
| PubChem CID | 129047046 |
| Molecular Formula | C84H96N2O8 |
| Molecular Weight | 1261.70 g/mol |
| Exact Mass | 1260.72 |
| IUPAC Name | 2,5-bis[6-[4-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]phenoxy]hexoxy]terephthalic acid |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(-c3ccc(OCCCCCCOc4cc(C(=O)O)c(OCCCCCCOc5ccc(-c6ccc(N(c7ccc(C(C)(C)C)cc7)c7ccc(C(C)(C)C)cc7)cc6)cc5)cc4C(=O)O)cc3)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C84H96N2O8/c1-81(2,3)63-29-41-69(42-30-63)85(70-43-31-64(32-44-70)82(4,5)6)67-37-21-59(22-38-67)61-25-49-73(50-26-61)91-53-17-13-15-19-55-93-77-57-76(80(89)90)78(58-75(77)79(87)88)94-56-20-16-14-18-54-92-74-51-27-62(28-52-74)60-23-39-68(40-24-60)86(71-45-33-65(34-46-71)83(7,8)9)72-47-35-66(36-48-72)84(10,11)12/h21-52,57-58H,13-20,53-56H2,1-12H3,(H,87,88)(H,89,90) |
| InChIKey | GZIDODRORRUJRR-UHFFFAOYSA-N |
| XLogP | 22.58 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 94 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1261.70 |
| LogP ≤ 5 | 22.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|