C16H27NO4Si — CID 171727294
tert-butyl-dimethyl-[(2-nitro-5-propoxyphenyl)methoxy]silane (PubChem CID 171727294) has the molecular formula C16H27NO4Si and a molecular weight of 325.48 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2-nitro-5-propoxyphenyl)methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2-nitro-5-propoxyphenyl)methoxy]silane |
|---|---|
| PubChem CID | 171727294 |
| Molecular Formula | C16H27NO4Si |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | tert-butyl-dimethyl-[(2-nitro-5-propoxyphenyl)methoxy]silane |
| SMILES | CCCOc1ccc([N+](=O)[O-])c(CO[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C16H27NO4Si/c1-7-10-20-14-8-9-15(17(18)19)13(11-14)12-21-22(5,6)16(2,3)4/h8-9,11H,7,10,12H2,1-6H3 |
| InChIKey | ZQMAFEXBNSNOAI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|