C26H45NO9Si — CID 169175784
tert-butyl-dimethyl-[2-[2-[2-[2-[2-[2-[2-[(E)-2-nitroethenyl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]silane (PubChem CID 169175784) has the molecular formula C26H45NO9Si and a molecular weight of 543.73 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-[2-[2-[2-[2-[2-[2-[(E)-2-nitroethenyl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-[2-[2-[2-[2-[2-[2-[(E)-2-nitroethenyl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]silane |
|---|---|
| PubChem CID | 169175784 |
| Molecular Formula | C26H45NO9Si |
| Molecular Weight | 543.73 g/mol |
| Exact Mass | 543.29 |
| IUPAC Name | tert-butyl-dimethyl-[2-[2-[2-[2-[2-[2-[2-[(E)-2-nitroethenyl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCOCCOCCOCCOCCOCCOc1ccccc1/C=C/[N+](=O)[O-] |
| InChI | InChI=1S/C26H45NO9Si/c1-26(2,3)37(4,5)36-23-21-34-19-17-32-15-13-30-12-14-31-16-18-33-20-22-35-25-9-7-6-8-24(25)10-11-27(28)29/h6-11H,12-23H2,1-5H3/b11-10+ |
| InChIKey | RFYVSXZFXRSOQC-ZHACJKMWSA-N |
| XLogP | 4.42 |
| TPSA | 107.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.73 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|