C16H25NO5Si — CID 22436279
3-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-nitrobenzaldehyde (PubChem CID 22436279) has the molecular formula C16H25NO5Si and a molecular weight of 339.46 g/mol. Its IUPAC name is 3-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-nitrobenzaldehyde.
| Compound Name | 3-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-nitrobenzaldehyde |
|---|---|
| PubChem CID | 22436279 |
| Molecular Formula | C16H25NO5Si |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 3-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-nitrobenzaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OCCCOc1cccc(C=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H25NO5Si/c1-16(2,3)23(4,5)22-11-7-10-21-14-9-6-8-13(12-18)15(14)17(19)20/h6,8-9,12H,7,10-11H2,1-5H3 |
| InChIKey | NXZWTSOPEXJBBE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|