C19H29FN4O5Si — CID 171084857
tert-butyl-[3-[1-[2-(fluoromethoxy)-3-pyridinyl]-5-methyl-4-nitropyrazol-3-yl]oxypropoxy]-dimethylsilane (PubChem CID 171084857) has the molecular formula C19H29FN4O5Si and a molecular weight of 440.55 g/mol. Its IUPAC name is tert-butyl-[3-[1-[2-(fluoromethoxy)-3-pyridinyl]-5-methyl-4-nitropyrazol-3-yl]oxypropoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-[1-[2-(fluoromethoxy)-3-pyridinyl]-5-methyl-4-nitropyrazol-3-yl]oxypropoxy]-dimethylsilane |
|---|---|
| PubChem CID | 171084857 |
| Molecular Formula | C19H29FN4O5Si |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | tert-butyl-[3-[1-[2-(fluoromethoxy)-3-pyridinyl]-5-methyl-4-nitropyrazol-3-yl]oxypropoxy]-dimethylsilane |
| SMILES | Cc1c([N+](=O)[O-])c(OCCCO[Si](C)(C)C(C)(C)C)nn1-c1cccnc1OCF |
| InChI | InChI=1S/C19H29FN4O5Si/c1-14-16(24(25)26)18(27-11-8-12-29-30(5,6)19(2,3)4)22-23(14)15-9-7-10-21-17(15)28-13-20/h7,9-10H,8,11-13H2,1-6H3 |
| InChIKey | SKAPIVIAMCFWCM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 101.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|