C20H32N4O5Si — CID 171084784
tert-butyl-[3-[1-(2-methoxy-5-methyl-3-pyridinyl)-5-methyl-4-nitropyrazol-3-yl]oxypropoxy]-dimethylsilane (PubChem CID 171084784) has the molecular formula C20H32N4O5Si and a molecular weight of 436.59 g/mol. Its IUPAC name is tert-butyl-[3-[1-(2-methoxy-5-methyl-3-pyridinyl)-5-methyl-4-nitropyrazol-3-yl]oxypropoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-[1-(2-methoxy-5-methyl-3-pyridinyl)-5-methyl-4-nitropyrazol-3-yl]oxypropoxy]-dimethylsilane |
|---|---|
| PubChem CID | 171084784 |
| Molecular Formula | C20H32N4O5Si |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | tert-butyl-[3-[1-(2-methoxy-5-methyl-3-pyridinyl)-5-methyl-4-nitropyrazol-3-yl]oxypropoxy]-dimethylsilane |
| SMILES | COc1ncc(C)cc1-n1nc(OCCCO[Si](C)(C)C(C)(C)C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C20H32N4O5Si/c1-14-12-16(18(27-6)21-13-14)23-15(2)17(24(25)26)19(22-23)28-10-9-11-29-30(7,8)20(3,4)5/h12-13H,9-11H2,1-8H3 |
| InChIKey | LUYBUUJRXSKMJG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 101.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|