About 2-nitro-1,3-dioctoxybenzene
2-nitro-1,3-dioctoxybenzene (PubChem CID 537243) has the molecular formula C22H37NO4
and a molecular weight of 379.54 g/mol. Its IUPAC name is 2-nitro-1,3-dioctoxybenzene.
Molecular Properties
| Compound Name | 2-nitro-1,3-dioctoxybenzene |
| PubChem CID | 537243 |
| Molecular Formula | C22H37NO4 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | 2-nitro-1,3-dioctoxybenzene |
| SMILES | CCCCCCCCOc1cccc(OCCCCCCCC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H37NO4/c1-3-5-7-9-11-13-18-26-20-16-15-17-21(22(20)23(24)25)27-19-14-12-10-8-6-4-2/h15-17H,3-14,18-19H2,1-2H3 |
| InChIKey | OFEWSXHPFIDSDF-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-1,3-dioctoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-1,3-dioctoxybenzene?
The IUPAC name of 2-nitro-1,3-dioctoxybenzene (CID 537243) is 2-nitro-1,3-dioctoxybenzene.
What is the SMILES notation for 2-nitro-1,3-dioctoxybenzene?
The canonical SMILES for 2-nitro-1,3-dioctoxybenzene is CCCCCCCCOc1cccc(OCCCCCCCC)c1[N+](=O)[O-].
What is the InChIKey of 2-nitro-1,3-dioctoxybenzene?
The InChIKey is OFEWSXHPFIDSDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H37NO4/c1-3-5-7-9-11-13-18-26-20-16-15-17-21(22(20)23(24)25)27-19-14-12-10-8-6-4-2/h15-17H,3-14,18-19H2,1-2H3.
What are the key properties of 2-nitro-1,3-dioctoxybenzene?
2-nitro-1,3-dioctoxybenzene has a molecular weight of 379.54 g/mol, XLogP of 7.07, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-1,3-dioctoxybenzene is sourced from PubChem (CID 537243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).