About 3-decoxy-2-nitropyridine
3-decoxy-2-nitropyridine (PubChem CID 152620226) has the molecular formula C15H24N2O3
and a molecular weight of 280.37 g/mol. Its IUPAC name is 3-decoxy-2-nitropyridine.
Molecular Properties
| Compound Name | 3-decoxy-2-nitropyridine |
| PubChem CID | 152620226 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 3-decoxy-2-nitropyridine |
| SMILES | CCCCCCCCCCOc1cccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H24N2O3/c1-2-3-4-5-6-7-8-9-13-20-14-11-10-12-16-15(14)17(18)19/h10-12H,2-9,13H2,1H3 |
| InChIKey | ZBIZTQMZCNLCQT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-decoxy-2-nitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-decoxy-2-nitropyridine?
The IUPAC name of 3-decoxy-2-nitropyridine (CID 152620226) is 3-decoxy-2-nitropyridine.
What is the SMILES notation for 3-decoxy-2-nitropyridine?
The canonical SMILES for 3-decoxy-2-nitropyridine is CCCCCCCCCCOc1cccnc1[N+](=O)[O-].
What is the InChIKey of 3-decoxy-2-nitropyridine?
The InChIKey is ZBIZTQMZCNLCQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O3/c1-2-3-4-5-6-7-8-9-13-20-14-11-10-12-16-15(14)17(18)19/h10-12H,2-9,13H2,1H3.
What are the key properties of 3-decoxy-2-nitropyridine?
3-decoxy-2-nitropyridine has a molecular weight of 280.37 g/mol, XLogP of 4.51, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-decoxy-2-nitropyridine is sourced from PubChem (CID 152620226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).