C13H9ClF2N2O3 — CID 90205884
3-[2-(2-chloro-3,6-difluorophenyl)ethoxy]-2-nitropyridine (PubChem CID 90205884) has the molecular formula C13H9ClF2N2O3 and a molecular weight of 314.68 g/mol. Its IUPAC name is 3-[2-(2-chloro-3,6-difluorophenyl)ethoxy]-2-nitropyridine.
| Compound Name | 3-[2-(2-chloro-3,6-difluorophenyl)ethoxy]-2-nitropyridine |
|---|---|
| PubChem CID | 90205884 |
| Molecular Formula | C13H9ClF2N2O3 |
| Molecular Weight | 314.68 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 3-[2-(2-chloro-3,6-difluorophenyl)ethoxy]-2-nitropyridine |
| SMILES | O=[N+]([O-])c1ncccc1OCCc1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C13H9ClF2N2O3/c14-12-8(9(15)3-4-10(12)16)5-7-21-11-2-1-6-17-13(11)18(19)20/h1-4,6H,5,7H2 |
| InChIKey | OIDITMFIQNPENR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.68 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|