C11H16N2O5 — CID 63628584
3-(2,2-diethoxyethoxy)-2-nitropyridine (PubChem CID 63628584) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is 3-(2,2-diethoxyethoxy)-2-nitropyridine.
| Compound Name | 3-(2,2-diethoxyethoxy)-2-nitropyridine |
|---|---|
| PubChem CID | 63628584 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 3-(2,2-diethoxyethoxy)-2-nitropyridine |
| SMILES | CCOC(COc1cccnc1[N+](=O)[O-])OCC |
| InChI | InChI=1S/C11H16N2O5/c1-3-16-10(17-4-2)8-18-9-6-5-7-12-11(9)13(14)15/h5-7,10H,3-4,8H2,1-2H3 |
| InChIKey | MUOPORBIEXMBNT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|