About tert-butyl-[3-(2-chlorophenoxy)propoxy]-dimethylsilane;carbon dioxide
tert-butyl-[3-(2-chlorophenoxy)propoxy]-dimethylsilane;carbon dioxide (PubChem CID 162028338) has the molecular formula C16H25ClO4Si
and a molecular weight of 344.91 g/mol. Its IUPAC name is tert-butyl-[3-(2-chlorophenoxy)propoxy]-dimethylsilane;carbon dioxide.
Molecular Properties
| Compound Name | tert-butyl-[3-(2-chlorophenoxy)propoxy]-dimethylsilane;carbon dioxide |
| PubChem CID | 162028338 |
| Molecular Formula | C16H25ClO4Si |
| Molecular Weight | 344.91 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | tert-butyl-[3-(2-chlorophenoxy)propoxy]-dimethylsilane;carbon dioxide |
| SMILES | CC(C)(C)[Si](C)(C)OCCCOc1ccccc1Cl.O=C=O |
| InChI | InChI=1S/C15H25ClO2Si.CO2/c1-15(2,3)19(4,5)18-12-8-11-17-14-10-7-6-9-13(14)16;2-1-3/h6-7,9-10H,8,11-12H2,1-5H3; |
| InChIKey | YVRKXOGJNKGUHA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.91 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[3-(2-chlorophenoxy)propoxy]-dimethylsilane;carbon dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[3-(2-chlorophenoxy)propoxy]-dimethylsilane;carbon dioxide?
The IUPAC name of tert-butyl-[3-(2-chlorophenoxy)propoxy]-dimethylsilane;carbon dioxide (CID 162028338) is tert-butyl-[3-(2-chlorophenoxy)propoxy]-dimethylsilane;carbon dioxide.
What is the SMILES notation for tert-butyl-[3-(2-chlorophenoxy)propoxy]-dimethylsilane;carbon dioxide?
The canonical SMILES for tert-butyl-[3-(2-chlorophenoxy)propoxy]-dimethylsilane;carbon dioxide is CC(C)(C)[Si](C)(C)OCCCOc1ccccc1Cl.O=C=O.
What is the InChIKey of tert-butyl-[3-(2-chlorophenoxy)propoxy]-dimethylsilane;carbon dioxide?
The InChIKey is YVRKXOGJNKGUHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25ClO2Si.CO2/c1-15(2,3)19(4,5)18-12-8-11-17-14-10-7-6-9-13(14)16;2-1-3/h6-7,9-10H,8,11-12H2,1-5H3;.
What are the key properties of tert-butyl-[3-(2-chlorophenoxy)propoxy]-dimethylsilane;carbon dioxide?
tert-butyl-[3-(2-chlorophenoxy)propoxy]-dimethylsilane;carbon dioxide has a molecular weight of 344.91 g/mol, XLogP of 4.55, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[3-(2-chlorophenoxy)propoxy]-dimethylsilane;carbon dioxide is sourced from PubChem (CID 162028338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).