C29H35Cl2NO4Si — CID 69233279
N-[2-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]-3,5-dichloro-4-phenylmethoxybenzamide (PubChem CID 69233279) has the molecular formula C29H35Cl2NO4Si and a molecular weight of 560.59 g/mol. Its IUPAC name is N-[2-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]-3,5-dichloro-4-phenylmethoxybenzamide.
| Compound Name | N-[2-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]-3,5-dichloro-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 69233279 |
| Molecular Formula | C29H35Cl2NO4Si |
| Molecular Weight | 560.59 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | N-[2-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]-3,5-dichloro-4-phenylmethoxybenzamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCCOc1ccccc1NC(=O)c1cc(Cl)c(OCc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C29H35Cl2NO4Si/c1-29(2,3)37(4,5)36-17-11-16-34-26-15-10-9-14-25(26)32-28(33)22-18-23(30)27(24(31)19-22)35-20-21-12-7-6-8-13-21/h6-10,12-15,18-19H,11,16-17,20H2,1-5H3,(H,32,33) |
| InChIKey | VYBTZNDODNDNFV-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.59 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|