C15H27NOSi — CID 18788179
2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]aniline (PubChem CID 18788179) has the molecular formula C15H27NOSi and a molecular weight of 265.47 g/mol. Its IUPAC name is 2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]aniline.
| Compound Name | 2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]aniline |
|---|---|
| PubChem CID | 18788179 |
| Molecular Formula | C15H27NOSi |
| Molecular Weight | 265.47 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]aniline |
| SMILES | CC(C)(C)[Si](C)(C)OCCCc1ccccc1N |
| InChI | InChI=1S/C15H27NOSi/c1-15(2,3)18(4,5)17-12-8-10-13-9-6-7-11-14(13)16/h6-7,9,11H,8,10,12,16H2,1-5H3 |
| InChIKey | CELMMESRJSXJID-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|