C18H34OSi2 — CID 102153241
tert-butyl-[4-[dimethyl(phenyl)silyl]butoxy]-dimethylsilane (PubChem CID 102153241) has the molecular formula C18H34OSi2 and a molecular weight of 322.64 g/mol. Its IUPAC name is tert-butyl-[4-[dimethyl(phenyl)silyl]butoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4-[dimethyl(phenyl)silyl]butoxy]-dimethylsilane |
|---|---|
| PubChem CID | 102153241 |
| Molecular Formula | C18H34OSi2 |
| Molecular Weight | 322.64 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | tert-butyl-[4-[dimethyl(phenyl)silyl]butoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C18H34OSi2/c1-18(2,3)21(6,7)19-15-11-12-16-20(4,5)17-13-9-8-10-14-17/h8-10,13-14H,11-12,15-16H2,1-7H3 |
| InChIKey | IAACVCKNSYXGCP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|