C27H44OSi2 — CID 11293613
tert-butyl-[5-[tert-butyl(dimethyl)silyl]oxypentyl]-diphenylsilane (PubChem CID 11293613) has the molecular formula C27H44OSi2 and a molecular weight of 440.82 g/mol. Its IUPAC name is tert-butyl-[5-[tert-butyl(dimethyl)silyl]oxypentyl]-diphenylsilane.
| Compound Name | tert-butyl-[5-[tert-butyl(dimethyl)silyl]oxypentyl]-diphenylsilane |
|---|---|
| PubChem CID | 11293613 |
| Molecular Formula | C27H44OSi2 |
| Molecular Weight | 440.82 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | tert-butyl-[5-[tert-butyl(dimethyl)silyl]oxypentyl]-diphenylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCC[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H44OSi2/c1-26(2,3)29(7,8)28-22-16-11-17-23-30(27(4,5)6,24-18-12-9-13-19-24)25-20-14-10-15-21-25/h9-10,12-15,18-21H,11,16-17,22-23H2,1-8H3 |
| InChIKey | IQLHMQCOOMGSII-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.82 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|