C26H50O2Si2 — CID 10789748
tert-butyl-[8-[tert-butyl(dimethyl)silyl]oxy-1-phenyloctoxy]-dimethylsilane (PubChem CID 10789748) has the molecular formula C26H50O2Si2 and a molecular weight of 450.86 g/mol. Its IUPAC name is tert-butyl-[8-[tert-butyl(dimethyl)silyl]oxy-1-phenyloctoxy]-dimethylsilane.
| Compound Name | tert-butyl-[8-[tert-butyl(dimethyl)silyl]oxy-1-phenyloctoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10789748 |
| Molecular Formula | C26H50O2Si2 |
| Molecular Weight | 450.86 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | tert-butyl-[8-[tert-butyl(dimethyl)silyl]oxy-1-phenyloctoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCCCC(O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C26H50O2Si2/c1-25(2,3)29(7,8)27-22-18-13-11-12-17-21-24(23-19-15-14-16-20-23)28-30(9,10)26(4,5)6/h14-16,19-20,24H,11-13,17-18,21-22H2,1-10H3 |
| InChIKey | IIAFBIROAUKQPW-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.86 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|