C19H35NO3SSi — CID 91798381
(1S)-5-[tert-butyl(dimethyl)silyl]oxy-N,N-dimethyl-1-phenylpentane-1-sulfonamide (PubChem CID 91798381) has the molecular formula C19H35NO3SSi and a molecular weight of 385.65 g/mol. Its IUPAC name is (1S)-5-[tert-butyl(dimethyl)silyl]oxy-N,N-dimethyl-1-phenylpentane-1-sulfonamide.
| Compound Name | (1S)-5-[tert-butyl(dimethyl)silyl]oxy-N,N-dimethyl-1-phenylpentane-1-sulfonamide |
|---|---|
| PubChem CID | 91798381 |
| Molecular Formula | C19H35NO3SSi |
| Molecular Weight | 385.65 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | (1S)-5-[tert-butyl(dimethyl)silyl]oxy-N,N-dimethyl-1-phenylpentane-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)[C@@H](CCCCO[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H35NO3SSi/c1-19(2,3)25(6,7)23-16-12-11-15-18(24(21,22)20(4)5)17-13-9-8-10-14-17/h8-10,13-14,18H,11-12,15-16H2,1-7H3/t18-/m0/s1 |
| InChIKey | RKCGIFYVHCYRMB-SFHVURJKSA-N |
| XLogP | 4.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.65 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|