C16H28O3Si — CID 175760972
(2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylbutane-1,2-diol (PubChem CID 175760972) has the molecular formula C16H28O3Si and a molecular weight of 296.48 g/mol. Its IUPAC name is (2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylbutane-1,2-diol.
| Compound Name | (2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylbutane-1,2-diol |
|---|---|
| PubChem CID | 175760972 |
| Molecular Formula | C16H28O3Si |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylbutane-1,2-diol |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H](O)C(O)c1ccccc1 |
| InChI | InChI=1S/C16H28O3Si/c1-16(2,3)20(4,5)19-12-11-14(17)15(18)13-9-7-6-8-10-13/h6-10,14-15,17-18H,11-12H2,1-5H3/t14-,15?/m1/s1 |
| InChIKey | CMDSYLBTSSTSCD-GICMACPYSA-N |
| XLogP | 3.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|