C27H41NO3Si — CID 10503965
(2R)-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbutanamide (PubChem CID 10503965) has the molecular formula C27H41NO3Si and a molecular weight of 455.72 g/mol. Its IUPAC name is (2R)-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbutanamide.
| Compound Name | (2R)-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbutanamide |
|---|---|
| PubChem CID | 10503965 |
| Molecular Formula | C27H41NO3Si |
| Molecular Weight | 455.72 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | (2R)-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbutanamide |
| SMILES | C[C@@H]([C@@H](O)c1ccccc1)N(C)C(=O)[C@@H](CCO[Si](C)(C)C(C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C27H41NO3Si/c1-21(25(29)23-16-12-9-13-17-23)28(5)26(30)24(20-22-14-10-8-11-15-22)18-19-31-32(6,7)27(2,3)4/h8-17,21,24-25,29H,18-20H2,1-7H3/t21-,24-,25+/m0/s1 |
| InChIKey | DXFGXXVXCJXGHS-GVXSCFBNSA-N |
| XLogP | 5.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.72 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|