C46H61NO4Si — CID 177465023
(Z,2S)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-[2-tri(propan-2-yl)silyloxyethyl]-6-trityloxyhex-4-enamide (PubChem CID 177465023) has the molecular formula C46H61NO4Si and a molecular weight of 720.08 g/mol. Its IUPAC name is (Z,2S)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-[2-tri(propan-2-yl)silyloxyethyl]-6-trityloxyhex-4-enamide.
| Compound Name | (Z,2S)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-[2-tri(propan-2-yl)silyloxyethyl]-6-trityloxyhex-4-enamide |
|---|---|
| PubChem CID | 177465023 |
| Molecular Formula | C46H61NO4Si |
| Molecular Weight | 720.08 g/mol |
| Exact Mass | 719.44 |
| IUPAC Name | (Z,2S)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-[2-tri(propan-2-yl)silyloxyethyl]-6-trityloxyhex-4-enamide |
| SMILES | CC(C)[Si](OCC[C@H](C/C=C\COC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C46H61NO4Si/c1-35(2)52(36(3)4,37(5)6)51-34-32-40(45(49)47(8)38(7)44(48)39-23-13-9-14-24-39)25-21-22-33-50-46(41-26-15-10-16-27-41,42-28-17-11-18-29-42)43-30-19-12-20-31-43/h9-24,26-31,35-38,40,44,48H,25,32-34H2,1-8H3/b22-21-/t38-,40-,44+/m0/s1 |
| InChIKey | ONCUDNGEVSARHT-ZFWFNVTCSA-N |
| XLogP | 10.72 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.08 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|