C31H38O5Si — CID 46179798
benzyl (2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-diphenylacetyl)oxybutanoate (PubChem CID 46179798) has the molecular formula C31H38O5Si and a molecular weight of 518.73 g/mol. Its IUPAC name is benzyl (2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-diphenylacetyl)oxybutanoate.
| Compound Name | benzyl (2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-diphenylacetyl)oxybutanoate |
|---|---|
| PubChem CID | 46179798 |
| Molecular Formula | C31H38O5Si |
| Molecular Weight | 518.73 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | benzyl (2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-diphenylacetyl)oxybutanoate |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H](OC(=O)C(c1ccccc1)c1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H38O5Si/c1-31(2,3)37(4,5)35-22-21-27(29(32)34-23-24-15-9-6-10-16-24)36-30(33)28(25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-20,27-28H,21-23H2,1-5H3/t27-/m1/s1 |
| InChIKey | SHNXKYUYZUFYOY-HHHXNRCGSA-N |
| XLogP | 6.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.73 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|